C14H8FN3O2 — CID 11076465
6-(3-fluoroanilino)quinazoline-5,8-dione (PubChem CID 11076465) has the molecular formula C14H8FN3O2 and a molecular weight of 269.24 g/mol. Its IUPAC name is 6-(3-fluoroanilino)quinazoline-5,8-dione.
| Compound Name | 6-(3-fluoroanilino)quinazoline-5,8-dione |
|---|---|
| PubChem CID | 11076465 |
| Molecular Formula | C14H8FN3O2 |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 6-(3-fluoroanilino)quinazoline-5,8-dione |
| SMILES | O=C1C(Nc2cccc(F)c2)=CC(=O)c2ncncc21 |
| InChI | InChI=1S/C14H8FN3O2/c15-8-2-1-3-9(4-8)18-11-5-12(19)13-10(14(11)20)6-16-7-17-13/h1-7,18H |
| InChIKey | AGCFRWQWWOFZTR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|