C15H8F2N2O2 — CID 15537861
6-(3,4-difluoroanilino)quinoline-5,8-dione (PubChem CID 15537861) has the molecular formula C15H8F2N2O2 and a molecular weight of 286.24 g/mol. Its IUPAC name is 6-(3,4-difluoroanilino)quinoline-5,8-dione.
| Compound Name | 6-(3,4-difluoroanilino)quinoline-5,8-dione |
|---|---|
| PubChem CID | 15537861 |
| Molecular Formula | C15H8F2N2O2 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 6-(3,4-difluoroanilino)quinoline-5,8-dione |
| SMILES | O=C1C(Nc2ccc(F)c(F)c2)=CC(=O)c2ncccc21 |
| InChI | InChI=1S/C15H8F2N2O2/c16-10-4-3-8(6-11(10)17)19-12-7-13(20)14-9(15(12)21)2-1-5-18-14/h1-7,19H |
| InChIKey | QFQQVVJZYNICIP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|