C13H10N2O4 — CID 15757688
N-(5,8-dioxoquinolin-6-yl)-3-oxobutanamide (PubChem CID 15757688) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is N-(5,8-dioxoquinolin-6-yl)-3-oxobutanamide.
| Compound Name | N-(5,8-dioxoquinolin-6-yl)-3-oxobutanamide |
|---|---|
| PubChem CID | 15757688 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(5,8-dioxoquinolin-6-yl)-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NC1=CC(=O)c2ncccc2C1=O |
| InChI | InChI=1S/C13H10N2O4/c1-7(16)5-11(18)15-9-6-10(17)12-8(13(9)19)3-2-4-14-12/h2-4,6H,5H2,1H3,(H,15,18) |
| InChIKey | QYLLEWCFZOJKMS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|