C20H14F3N3O4 — CID 10873446
N-[3-[2-[(5,8-dioxoquinolin-6-yl)amino]phenyl]-3-oxopropyl]-2,2,2-trifluoroacetamide (PubChem CID 10873446) has the molecular formula C20H14F3N3O4 and a molecular weight of 417.34 g/mol. Its IUPAC name is N-[3-[2-[(5,8-dioxoquinolin-6-yl)amino]phenyl]-3-oxopropyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[2-[(5,8-dioxoquinolin-6-yl)amino]phenyl]-3-oxopropyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 10873446 |
| Molecular Formula | C20H14F3N3O4 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-[3-[2-[(5,8-dioxoquinolin-6-yl)amino]phenyl]-3-oxopropyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CCNC(=O)C(F)(F)F)c1ccccc1NC1=CC(=O)c2ncccc2C1=O |
| InChI | InChI=1S/C20H14F3N3O4/c21-20(22,23)19(30)25-9-7-15(27)11-4-1-2-6-13(11)26-14-10-16(28)17-12(18(14)29)5-3-8-24-17/h1-6,8,10,26H,7,9H2,(H,25,30) |
| InChIKey | IOTVKRRPEPVFKQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|