C11H11F3N2O3 — CID 108537618
2-hydroxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide (PubChem CID 108537618) has the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-hydroxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide.
| Compound Name | 2-hydroxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108537618 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-hydroxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)C(F)(F)F)c1ccccc1O |
| InChI | InChI=1S/C11H11F3N2O3/c12-11(13,14)10(19)16-6-5-15-9(18)7-3-1-2-4-8(7)17/h1-4,17H,5-6H2,(H,15,18)(H,16,19) |
| InChIKey | UDOUZLMCYVFPKY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|