C12H13F3N2O3 — CID 162537495
N-[3-(2-amino-5-methoxyphenyl)-3-oxopropyl]-2,2,2-trifluoroacetamide (PubChem CID 162537495) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is N-[3-(2-amino-5-methoxyphenyl)-3-oxopropyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(2-amino-5-methoxyphenyl)-3-oxopropyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162537495 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[3-(2-amino-5-methoxyphenyl)-3-oxopropyl]-2,2,2-trifluoroacetamide |
| SMILES | COc1ccc(N)c(C(=O)CCNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2O3/c1-20-7-2-3-9(16)8(6-7)10(18)4-5-17-11(19)12(13,14)15/h2-3,6H,4-5,16H2,1H3,(H,17,19) |
| InChIKey | FMKQAYGMOBOKEZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|