C10H12F2N2O2 — CID 115405286
2-amino-N-(2,2-difluoroethyl)-5-methoxybenzamide (PubChem CID 115405286) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoroethyl)-5-methoxybenzamide.
| Compound Name | 2-amino-N-(2,2-difluoroethyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 115405286 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-amino-N-(2,2-difluoroethyl)-5-methoxybenzamide |
| SMILES | COc1ccc(N)c(C(=O)NCC(F)F)c1 |
| InChI | InChI=1S/C10H12F2N2O2/c1-16-6-2-3-8(13)7(4-6)10(15)14-5-9(11)12/h2-4,9H,5,13H2,1H3,(H,14,15) |
| InChIKey | ZLHQQAXAZJCJLX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|