C12H18N2O4 — CID 66169982
2-amino-N-(2,3-dihydroxy-2-methylpropyl)-5-methoxybenzamide (PubChem CID 66169982) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-amino-N-(2,3-dihydroxy-2-methylpropyl)-5-methoxybenzamide.
| Compound Name | 2-amino-N-(2,3-dihydroxy-2-methylpropyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 66169982 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-amino-N-(2,3-dihydroxy-2-methylpropyl)-5-methoxybenzamide |
| SMILES | COc1ccc(N)c(C(=O)NCC(C)(O)CO)c1 |
| InChI | InChI=1S/C12H18N2O4/c1-12(17,7-15)6-14-11(16)9-5-8(18-2)3-4-10(9)13/h3-5,15,17H,6-7,13H2,1-2H3,(H,14,16) |
| InChIKey | PYJNGIJKGPVEFF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|