C11H13N3O2 — CID 115412506
2-amino-N-(2-cyanoethyl)-5-methoxybenzamide (PubChem CID 115412506) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-amino-N-(2-cyanoethyl)-5-methoxybenzamide.
| Compound Name | 2-amino-N-(2-cyanoethyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 115412506 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 2-amino-N-(2-cyanoethyl)-5-methoxybenzamide |
| SMILES | COc1ccc(N)c(C(=O)NCCC#N)c1 |
| InChI | InChI=1S/C11H13N3O2/c1-16-8-3-4-10(13)9(7-8)11(15)14-6-2-5-12/h3-4,7H,2,6,13H2,1H3,(H,14,15) |
| InChIKey | ITBKBGONXZOWJC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|