C21H13N3O3 — CID 132547133
6-(4-benzoylanilino)quinazoline-5,8-dione (PubChem CID 132547133) has the molecular formula C21H13N3O3 and a molecular weight of 355.35 g/mol. Its IUPAC name is 6-(4-benzoylanilino)quinazoline-5,8-dione.
| Compound Name | 6-(4-benzoylanilino)quinazoline-5,8-dione |
|---|---|
| PubChem CID | 132547133 |
| Molecular Formula | C21H13N3O3 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 6-(4-benzoylanilino)quinazoline-5,8-dione |
| SMILES | O=C(c1ccccc1)c1ccc(NC2=CC(=O)c3ncncc3C2=O)cc1 |
| InChI | InChI=1S/C21H13N3O3/c25-18-10-17(21(27)16-11-22-12-23-19(16)18)24-15-8-6-14(7-9-15)20(26)13-4-2-1-3-5-13/h1-12,24H |
| InChIKey | PHAAGLFDGHGORP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|