C21H14N2O2 — CID 157499085
6-[(4-phenylphenyl)methyl]quinazoline-5,8-dione (PubChem CID 157499085) has the molecular formula C21H14N2O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 6-[(4-phenylphenyl)methyl]quinazoline-5,8-dione.
| Compound Name | 6-[(4-phenylphenyl)methyl]quinazoline-5,8-dione |
|---|---|
| PubChem CID | 157499085 |
| Molecular Formula | C21H14N2O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 6-[(4-phenylphenyl)methyl]quinazoline-5,8-dione |
| SMILES | O=C1C(Cc2ccc(-c3ccccc3)cc2)=CC(=O)c2ncncc21 |
| InChI | InChI=1S/C21H14N2O2/c24-19-11-17(21(25)18-12-22-13-23-20(18)19)10-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-9,11-13H,10H2 |
| InChIKey | JHQGPRBJGVPAKP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|