C19H19N5O4 — CID 162645436
6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione (PubChem CID 162645436) has the molecular formula C19H19N5O4 and a molecular weight of 381.39 g/mol. Its IUPAC name is 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione.
| Compound Name | 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione |
|---|---|
| PubChem CID | 162645436 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione |
| SMILES | CN1C(O)CN(c2ccc(NC3=CC(=O)c4ncncc4C3=O)cc2)CC1O |
| InChI | InChI=1S/C19H19N5O4/c1-23-16(26)8-24(9-17(23)27)12-4-2-11(3-5-12)22-14-6-15(25)18-13(19(14)28)7-20-10-21-18/h2-7,10,16-17,22,26-27H,8-9H2,1H3 |
| InChIKey | WHQWZQNOCBRKFV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|