About 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione
6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione (PubChem CID 162645436) has the molecular formula C19H19N5O4
and a molecular weight of 381.39 g/mol. Its IUPAC name is 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione.
Molecular Properties
| Compound Name | 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione |
| PubChem CID | 162645436 |
| Molecular Formula | C19H19N5O4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione |
| SMILES | CN1C(O)CN(c2ccc(NC3=CC(=O)c4ncncc4C3=O)cc2)CC1O |
| InChI | InChI=1S/C19H19N5O4/c1-23-16(26)8-24(9-17(23)27)12-4-2-11(3-5-12)22-14-6-15(25)18-13(19(14)28)7-20-10-21-18/h2-7,10,16-17,22,26-27H,8-9H2,1H3 |
| InChIKey | WHQWZQNOCBRKFV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione?
The IUPAC name of 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione (CID 162645436) is 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione.
What is the SMILES notation for 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione?
The canonical SMILES for 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione is CN1C(O)CN(c2ccc(NC3=CC(=O)c4ncncc4C3=O)cc2)CC1O.
What is the InChIKey of 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione?
The InChIKey is WHQWZQNOCBRKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N5O4/c1-23-16(26)8-24(9-17(23)27)12-4-2-11(3-5-12)22-14-6-15(25)18-13(19(14)28)7-20-10-21-18/h2-7,10,16-17,22,26-27H,8-9H2,1H3.
What are the key properties of 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione?
6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione has a molecular weight of 381.39 g/mol, XLogP of 0.24, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(3,5-dihydroxy-4-methylpiperazin-1-yl)anilino]quinazoline-5,8-dione is sourced from PubChem (CID 162645436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).