C15H9BrFN3O3 — CID 178179603
7-bromo-6-(4-fluoro-3-methoxyanilino)quinazoline-5,8-dione (PubChem CID 178179603) has the molecular formula C15H9BrFN3O3 and a molecular weight of 378.16 g/mol. Its IUPAC name is 7-bromo-6-(4-fluoro-3-methoxyanilino)quinazoline-5,8-dione.
| Compound Name | 7-bromo-6-(4-fluoro-3-methoxyanilino)quinazoline-5,8-dione |
|---|---|
| PubChem CID | 178179603 |
| Molecular Formula | C15H9BrFN3O3 |
| Molecular Weight | 378.16 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 7-bromo-6-(4-fluoro-3-methoxyanilino)quinazoline-5,8-dione |
| SMILES | COc1cc(NC2=C(Br)C(=O)c3ncncc3C2=O)ccc1F |
| InChI | InChI=1S/C15H9BrFN3O3/c1-23-10-4-7(2-3-9(10)17)20-13-11(16)15(22)12-8(14(13)21)5-18-6-19-12/h2-6,20H,1H3 |
| InChIKey | CRLLFMUJISMPMX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.16 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|