C14H6ClF2N3O2 — CID 86042324
7-chloro-6-(3,4-difluoroanilino)quinazoline-5,8-dione (PubChem CID 86042324) has the molecular formula C14H6ClF2N3O2 and a molecular weight of 321.67 g/mol. Its IUPAC name is 7-chloro-6-(3,4-difluoroanilino)quinazoline-5,8-dione.
| Compound Name | 7-chloro-6-(3,4-difluoroanilino)quinazoline-5,8-dione |
|---|---|
| PubChem CID | 86042324 |
| Molecular Formula | C14H6ClF2N3O2 |
| Molecular Weight | 321.67 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 7-chloro-6-(3,4-difluoroanilino)quinazoline-5,8-dione |
| SMILES | O=C1C(Nc2ccc(F)c(F)c2)=C(Cl)C(=O)c2ncncc21 |
| InChI | InChI=1S/C14H6ClF2N3O2/c15-10-12(20-6-1-2-8(16)9(17)3-6)13(21)7-4-18-5-19-11(7)14(10)22/h1-5,20H |
| InChIKey | PVSAYRCAXVCWGW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.67 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|