C19H21N5O3 — CID 162647535
7-hydroxy-6-[4-(4-methylpiperazin-1-yl)anilino]-6,7-dihydroquinazoline-5,8-dione (PubChem CID 162647535) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 7-hydroxy-6-[4-(4-methylpiperazin-1-yl)anilino]-6,7-dihydroquinazoline-5,8-dione.
| Compound Name | 7-hydroxy-6-[4-(4-methylpiperazin-1-yl)anilino]-6,7-dihydroquinazoline-5,8-dione |
|---|---|
| PubChem CID | 162647535 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 7-hydroxy-6-[4-(4-methylpiperazin-1-yl)anilino]-6,7-dihydroquinazoline-5,8-dione |
| SMILES | CN1CCN(c2ccc(NC3C(=O)c4cncnc4C(=O)C3O)cc2)CC1 |
| InChI | InChI=1S/C19H21N5O3/c1-23-6-8-24(9-7-23)13-4-2-12(3-5-13)22-16-17(25)14-10-20-11-21-15(14)18(26)19(16)27/h2-5,10-11,16,19,22,27H,6-9H2,1H3 |
| InChIKey | PQHLDZPMNDZCQW-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|