C23H24N6O5 — CID 130182484
methyl 4-[4-[3-(1-oxido-3,8-dioxo-1H-diazeto[3,4-g]quinazolin-1-ium-2-yl)propyl]piperazin-1-yl]benzoate (PubChem CID 130182484) has the molecular formula C23H24N6O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is methyl 4-[4-[3-(1-oxido-3,8-dioxo-1H-diazeto[3,4-g]quinazolin-1-ium-2-yl)propyl]piperazin-1-yl]benzoate.
| Compound Name | methyl 4-[4-[3-(1-oxido-3,8-dioxo-1H-diazeto[3,4-g]quinazolin-1-ium-2-yl)propyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 130182484 |
| Molecular Formula | C23H24N6O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | methyl 4-[4-[3-(1-oxido-3,8-dioxo-1H-diazeto[3,4-g]quinazolin-1-ium-2-yl)propyl]piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(CCCN3C4=C(C(=O)c5cncnc5C4=O)[NH+]3[O-])CC2)cc1 |
| InChI | InChI=1S/C23H24N6O5/c1-34-23(32)15-3-5-16(6-4-15)27-11-9-26(10-12-27)7-2-8-28-19-20(29(28)33)21(30)17-13-24-14-25-18(17)22(19)31/h3-6,13-14,29H,2,7-12H2,1H3 |
| InChIKey | QCHUEXZWODZXFB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|