C22H27N5O3 — CID 15288323
methyl 3-[3-[4-(5-methoxypyrimidin-4-yl)piperazin-1-yl]propyl]-1H-indole-5-carboxylate (PubChem CID 15288323) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is methyl 3-[3-[4-(5-methoxypyrimidin-4-yl)piperazin-1-yl]propyl]-1H-indole-5-carboxylate.
| Compound Name | methyl 3-[3-[4-(5-methoxypyrimidin-4-yl)piperazin-1-yl]propyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 15288323 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | methyl 3-[3-[4-(5-methoxypyrimidin-4-yl)piperazin-1-yl]propyl]-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]cc(CCCN3CCN(c4ncncc4OC)CC3)c2c1 |
| InChI | InChI=1S/C22H27N5O3/c1-29-20-14-23-15-25-21(20)27-10-8-26(9-11-27)7-3-4-17-13-24-19-6-5-16(12-18(17)19)22(28)30-2/h5-6,12-15,24H,3-4,7-11H2,1-2H3 |
| InChIKey | GDJRVMWAHVYIST-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |