C24H28N5O5+ — CID 143765015
[(3-amino-1,4-dioxonaphthalen-2-yl)-[2-[4-(4-methoxycarbonylphenyl)piperazin-1-yl]ethyl]amino]-hydroxyazanium (PubChem CID 143765015) has the molecular formula C24H28N5O5+ and a molecular weight of 466.52 g/mol. Its IUPAC name is [(3-amino-1,4-dioxonaphthalen-2-yl)-[2-[4-(4-methoxycarbonylphenyl)piperazin-1-yl]ethyl]amino]-hydroxyazanium.
| Compound Name | [(3-amino-1,4-dioxonaphthalen-2-yl)-[2-[4-(4-methoxycarbonylphenyl)piperazin-1-yl]ethyl]amino]-hydroxyazanium |
|---|---|
| PubChem CID | 143765015 |
| Molecular Formula | C24H28N5O5+ |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [(3-amino-1,4-dioxonaphthalen-2-yl)-[2-[4-(4-methoxycarbonylphenyl)piperazin-1-yl]ethyl]amino]-hydroxyazanium |
| SMILES | COC(=O)c1ccc(N2CCN(CCN([NH2+]O)C3=C(N)C(=O)c4ccccc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C24H27N5O5/c1-34-24(32)16-6-8-17(9-7-16)28-13-10-27(11-14-28)12-15-29(26-33)21-20(25)22(30)18-4-2-3-5-19(18)23(21)31/h2-9,26,33H,10-15,25H2,1H3/p+1 |
| InChIKey | JLXAHQJDERAQLK-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 133.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|