C24H29N4O6+ — CID 143765036
2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium (PubChem CID 143765036) has the molecular formula C24H29N4O6+ and a molecular weight of 469.52 g/mol. Its IUPAC name is 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium.
| Compound Name | 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium |
|---|---|
| PubChem CID | 143765036 |
| Molecular Formula | C24H29N4O6+ |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium |
| SMILES | CO[NH3+].NC1=C(NCCOC(=O)c2ccc(N3CCOCC3)cc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23N3O5.CH6NO/c24-19-20(22(28)18-4-2-1-3-17(18)21(19)27)25-9-12-31-23(29)15-5-7-16(8-6-15)26-10-13-30-14-11-26;1-3-2/h1-8,25H,9-14,24H2;1-2H3/q;+1 |
| InChIKey | YGDUELVUYSGFCC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 147.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|