About 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium
2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium (PubChem CID 143765036) has the molecular formula C24H29N4O6+
and a molecular weight of 469.52 g/mol. Its IUPAC name is 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium.
Molecular Properties
| Compound Name | 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium |
| PubChem CID | 143765036 |
| Molecular Formula | C24H29N4O6+ |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium |
| SMILES | CO[NH3+].NC1=C(NCCOC(=O)c2ccc(N3CCOCC3)cc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23N3O5.CH6NO/c24-19-20(22(28)18-4-2-1-3-17(18)21(19)27)25-9-12-31-23(29)15-5-7-16(8-6-15)26-10-13-30-14-11-26;1-3-2/h1-8,25H,9-14,24H2;1-2H3/q;+1 |
| InChIKey | YGDUELVUYSGFCC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 147.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium?
The IUPAC name of 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium (CID 143765036) is 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium.
What is the SMILES notation for 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium?
The canonical SMILES for 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium is CO[NH3+].NC1=C(NCCOC(=O)c2ccc(N3CCOCC3)cc2)C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium?
The InChIKey is YGDUELVUYSGFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O5.CH6NO/c24-19-20(22(28)18-4-2-1-3-17(18)21(19)27)25-9-12-31-23(29)15-5-7-16(8-6-15)26-10-13-30-14-11-26;1-3-2/h1-8,25H,9-14,24H2;1-2H3/q;+1.
What are the key properties of 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium?
2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium has a molecular weight of 469.52 g/mol, XLogP of 0.31, 6 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-amino-1,4-dioxonaphthalen-2-yl)amino]ethyl 4-morpholin-4-ylbenzoate;methoxyazanium is sourced from PubChem (CID 143765036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).