C12H7F4N — CID 82536889
N-(3,5-difluorophenyl)-3,4-difluoroaniline (PubChem CID 82536889) has the molecular formula C12H7F4N and a molecular weight of 241.19 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-3,4-difluoroaniline.
| Compound Name | N-(3,5-difluorophenyl)-3,4-difluoroaniline |
|---|---|
| PubChem CID | 82536889 |
| Molecular Formula | C12H7F4N |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-(3,5-difluorophenyl)-3,4-difluoroaniline |
| SMILES | Fc1cc(F)cc(Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C12H7F4N/c13-7-3-8(14)5-10(4-7)17-9-1-2-11(15)12(16)6-9/h1-6,17H |
| InChIKey | QYANLOWRSOEJRF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |