C16H10F3N3O4S — CID 178179575
7-methylsulfonyl-6-[3-(trifluoromethyl)anilino]quinazoline-5,8-dione (PubChem CID 178179575) has the molecular formula C16H10F3N3O4S and a molecular weight of 397.33 g/mol. Its IUPAC name is 7-methylsulfonyl-6-[3-(trifluoromethyl)anilino]quinazoline-5,8-dione.
| Compound Name | 7-methylsulfonyl-6-[3-(trifluoromethyl)anilino]quinazoline-5,8-dione |
|---|---|
| PubChem CID | 178179575 |
| Molecular Formula | C16H10F3N3O4S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 7-methylsulfonyl-6-[3-(trifluoromethyl)anilino]quinazoline-5,8-dione |
| SMILES | CS(=O)(=O)C1=C(Nc2cccc(C(F)(F)F)c2)C(=O)c2cncnc2C1=O |
| InChI | InChI=1S/C16H10F3N3O4S/c1-27(25,26)15-12(13(23)10-6-20-7-21-11(10)14(15)24)22-9-4-2-3-8(5-9)16(17,18)19/h2-7,22H,1H3 |
| InChIKey | VURHHSPNOJBOIU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|