C23H16F3N2O2+ — CID 4545636
2-(4-methylpyridin-1-ium-1-yl)-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione (PubChem CID 4545636) has the molecular formula C23H16F3N2O2+ and a molecular weight of 409.39 g/mol. Its IUPAC name is 2-(4-methylpyridin-1-ium-1-yl)-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione.
| Compound Name | 2-(4-methylpyridin-1-ium-1-yl)-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 4545636 |
| Molecular Formula | C23H16F3N2O2+ |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-(4-methylpyridin-1-ium-1-yl)-3-[3-(trifluoromethyl)anilino]naphthalene-1,4-dione |
| SMILES | Cc1cc[n+](C2=C(Nc3cccc(C(F)(F)F)c3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H15F3N2O2/c1-14-9-11-28(12-10-14)20-19(21(29)17-7-2-3-8-18(17)22(20)30)27-16-6-4-5-15(13-16)23(24,25)26/h2-13H,1H3/p+1 |
| InChIKey | QQICKZCQERBNLR-UHFFFAOYSA-O |
| XLogP | 4.66 |
| TPSA | 50.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|