C22H15Cl2N2O2+ — CID 19209277
2-(3,5-dichloroanilino)-3-(4-methylpyridin-1-ium-1-yl)naphthalene-1,4-dione (PubChem CID 19209277) has the molecular formula C22H15Cl2N2O2+ and a molecular weight of 410.28 g/mol. Its IUPAC name is 2-(3,5-dichloroanilino)-3-(4-methylpyridin-1-ium-1-yl)naphthalene-1,4-dione.
| Compound Name | 2-(3,5-dichloroanilino)-3-(4-methylpyridin-1-ium-1-yl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 19209277 |
| Molecular Formula | C22H15Cl2N2O2+ |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-(3,5-dichloroanilino)-3-(4-methylpyridin-1-ium-1-yl)naphthalene-1,4-dione |
| SMILES | Cc1cc[n+](C2=C(Nc3cc(Cl)cc(Cl)c3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H14Cl2N2O2/c1-13-6-8-26(9-7-13)20-19(25-16-11-14(23)10-15(24)12-16)21(27)17-4-2-3-5-18(17)22(20)28/h2-12H,1H3/p+1 |
| InChIKey | LAGFMWZKFFYXDO-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 50.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|