C24H21IN2O2 — CID 19209260
2-(2-ethylanilino)-3-(4-methylpyridin-1-ium-1-yl)naphthalene-1,4-dione iodide (PubChem CID 19209260) has the molecular formula C24H21IN2O2 and a molecular weight of 496.35 g/mol. Its IUPAC name is 2-(2-ethylanilino)-3-(4-methylpyridin-1-ium-1-yl)naphthalene-1,4-dione iodide.
| Compound Name | 2-(2-ethylanilino)-3-(4-methylpyridin-1-ium-1-yl)naphthalene-1,4-dione iodide |
|---|---|
| PubChem CID | 19209260 |
| Molecular Formula | C24H21IN2O2 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 2-(2-ethylanilino)-3-(4-methylpyridin-1-ium-1-yl)naphthalene-1,4-dione iodide |
| SMILES | CCc1ccccc1NC1=C([n+]2ccc(C)cc2)C(=O)c2ccccc2C1=O.[I-] |
| InChI | InChI=1S/C24H20N2O2.HI/c1-3-17-8-4-7-11-20(17)25-21-22(26-14-12-16(2)13-15-26)24(28)19-10-6-5-9-18(19)23(21)27;/h4-15H,3H2,1-2H3;1H |
| InChIKey | HIGKWFSTKTYBFV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|