C22H16ClN2O2+ — CID 19209247
2-(4-chloro-2-methylanilino)-3-pyridin-1-ium-1-ylnaphthalene-1,4-dione (PubChem CID 19209247) has the molecular formula C22H16ClN2O2+ and a molecular weight of 375.84 g/mol. Its IUPAC name is 2-(4-chloro-2-methylanilino)-3-pyridin-1-ium-1-ylnaphthalene-1,4-dione.
| Compound Name | 2-(4-chloro-2-methylanilino)-3-pyridin-1-ium-1-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 19209247 |
| Molecular Formula | C22H16ClN2O2+ |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-(4-chloro-2-methylanilino)-3-pyridin-1-ium-1-ylnaphthalene-1,4-dione |
| SMILES | Cc1cc(Cl)ccc1NC1=C([n+]2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H15ClN2O2/c1-14-13-15(23)9-10-18(14)24-19-20(25-11-5-2-6-12-25)22(27)17-8-4-3-7-16(17)21(19)26/h2-13H,1H3/p+1 |
| InChIKey | PSBRSJWWBGJACJ-UHFFFAOYSA-O |
| XLogP | 4.30 |
| TPSA | 50.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|