C25H23N2O2+ — CID 19209220
2-(2,6-diethylanilino)-3-pyridin-1-ium-1-ylnaphthalene-1,4-dione (PubChem CID 19209220) has the molecular formula C25H23N2O2+ and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-(2,6-diethylanilino)-3-pyridin-1-ium-1-ylnaphthalene-1,4-dione.
| Compound Name | 2-(2,6-diethylanilino)-3-pyridin-1-ium-1-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 19209220 |
| Molecular Formula | C25H23N2O2+ |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-(2,6-diethylanilino)-3-pyridin-1-ium-1-ylnaphthalene-1,4-dione |
| SMILES | CCc1cccc(CC)c1NC1=C([n+]2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H22N2O2/c1-3-17-11-10-12-18(4-2)21(17)26-22-23(27-15-8-5-9-16-27)25(29)20-14-7-6-13-19(20)24(22)28/h5-16H,3-4H2,1-2H3/p+1 |
| InChIKey | HNYYNCLVZTUJGZ-UHFFFAOYSA-O |
| XLogP | 4.46 |
| TPSA | 50.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|