C7H3N3 — CID 172544070
3,5,9-triazatricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaene (PubChem CID 172544070) has the molecular formula C7H3N3 and a molecular weight of 129.12 g/mol. Its IUPAC name is 3,5,9-triazatricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaene.
| Compound Name | 3,5,9-triazatricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 172544070 |
| Molecular Formula | C7H3N3 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | 3,5,9-triazatricyclo[5.3.0.02,6]deca-1,3,5,7,9-pentaene |
| SMILES | c1nc2c3cncc-3c-2n1 |
| InChI | InChI=1S/C7H3N3/c1-4-5(2-8-1)7-6(4)9-3-10-7/h1-3H |
| InChIKey | FFYDNNSCKZEDBV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |