C8H5N3 — CID 134572837
2,8,10-triazabicyclo[5.4.0]undeca-1(11),2,3,5,7,9-hexaene (PubChem CID 134572837) has the molecular formula C8H5N3 and a molecular weight of 143.15 g/mol. Its IUPAC name is 2,8,10-triazabicyclo[5.4.0]undeca-1(11),2,3,5,7,9-hexaene.
| Compound Name | 2,8,10-triazabicyclo[5.4.0]undeca-1(11),2,3,5,7,9-hexaene |
|---|---|
| PubChem CID | 134572837 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 2,8,10-triazabicyclo[5.4.0]undeca-1(11),2,3,5,7,9-hexaene |
| SMILES | C1=CC=Cc2ncncc2N=1 |
| InChI | InChI=1S/C8H5N3/c1-2-4-10-8-5-9-6-11-7(8)3-1/h1-3,5-6H |
| InChIKey | SJOROHLOTIJTGV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |