C9H10N4 — CID 142157693
7,7-dimethylpyrimido[5,4-e][1,4]diazepine (PubChem CID 142157693) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 7,7-dimethylpyrimido[5,4-e][1,4]diazepine.
| Compound Name | 7,7-dimethylpyrimido[5,4-e][1,4]diazepine |
|---|---|
| PubChem CID | 142157693 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 7,7-dimethylpyrimido[5,4-e][1,4]diazepine |
| SMILES | CC1(C)C=Nc2cncnc2C=N1 |
| InChI | InChI=1S/C9H10N4/c1-9(2)5-11-7-3-10-6-12-8(7)4-13-9/h3-6H,1-2H3 |
| InChIKey | CZERGQBZUQGXPC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |