C5H5N3S2 — CID 173233981
8-methyl-8λ4,9-dithia-2,4,7-triazabicyclo[4.3.0]nona-1,3,5,7-tetraene (PubChem CID 173233981) has the molecular formula C5H5N3S2 and a molecular weight of 171.25 g/mol. Its IUPAC name is 8-methyl-8λ4,9-dithia-2,4,7-triazabicyclo[4.3.0]nona-1,3,5,7-tetraene.
| Compound Name | 8-methyl-8λ4,9-dithia-2,4,7-triazabicyclo[4.3.0]nona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 173233981 |
| Molecular Formula | C5H5N3S2 |
| Molecular Weight | 171.25 g/mol |
| Exact Mass | 170.99 |
| IUPAC Name | 8-methyl-8λ4,9-dithia-2,4,7-triazabicyclo[4.3.0]nona-1,3,5,7-tetraene |
| SMILES | CS1=Nc2cncnc2S1 |
| InChI | InChI=1S/C5H5N3S2/c1-10-8-4-2-6-3-7-5(4)9-10/h2-3H,1H3 |
| InChIKey | GLTAUHWJTJHGAM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|