C6H4N2OS — CID 140897228
thieno[2,3-d]pyrimidin-5-one (PubChem CID 140897228) has the molecular formula C6H4N2OS and a molecular weight of 152.18 g/mol. Its IUPAC name is thieno[2,3-d]pyrimidin-5-one.
| Compound Name | thieno[2,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 140897228 |
| Molecular Formula | C6H4N2OS |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | thieno[2,3-d]pyrimidin-5-one |
| SMILES | O=C1CSc2ncncc21 |
| InChI | InChI=1S/C6H4N2OS/c9-5-2-10-6-4(5)1-7-3-8-6/h1,3H,2H2 |
| InChIKey | VLELRJIJCYMACZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |