C7H9N2OPS — CID 145128567
methylphosphane;thieno[2,3-d]pyrimidin-5-one (PubChem CID 145128567) has the molecular formula C7H9N2OPS and a molecular weight of 200.20 g/mol. Its IUPAC name is methylphosphane;thieno[2,3-d]pyrimidin-5-one.
| Compound Name | methylphosphane;thieno[2,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 145128567 |
| Molecular Formula | C7H9N2OPS |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | methylphosphane;thieno[2,3-d]pyrimidin-5-one |
| SMILES | CP.O=C1CSc2ncncc21 |
| InChI | InChI=1S/C6H4N2OS.CH5P/c9-5-2-10-6-4(5)1-7-3-8-6;1-2/h1,3H,2H2;2H2,1H3 |
| InChIKey | RVASGMUDYZWVSU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|