C6H6N4S — CID 129151493
N-methyl-[1,2]thiazolo[3,4-d]pyrimidin-3-amine (PubChem CID 129151493) has the molecular formula C6H6N4S and a molecular weight of 166.21 g/mol. Its IUPAC name is N-methyl-[1,2]thiazolo[3,4-d]pyrimidin-3-amine.
| Compound Name | N-methyl-[1,2]thiazolo[3,4-d]pyrimidin-3-amine |
|---|---|
| PubChem CID | 129151493 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | N-methyl-[1,2]thiazolo[3,4-d]pyrimidin-3-amine |
| SMILES | CNc1snc2ncncc12 |
| InChI | InChI=1S/C6H6N4S/c1-7-6-4-2-8-3-9-5(4)10-11-6/h2-3,7H,1H3 |
| InChIKey | KBFDZDHFXAFHRA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |