C7H10N4 — CID 143435475
acetylene;5-N-methylpyrimidine-4,5-diamine (PubChem CID 143435475) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is acetylene;5-N-methylpyrimidine-4,5-diamine.
| Compound Name | acetylene;5-N-methylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 143435475 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | acetylene;5-N-methylpyrimidine-4,5-diamine |
| SMILES | C#C.CNc1cncnc1N |
| InChI | InChI=1S/C5H8N4.C2H2/c1-7-4-2-8-3-9-5(4)6;1-2/h2-3,7H,1H3,(H2,6,8,9);1-2H |
| InChIKey | SBRLCGSTKPWEQD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|