C7H8N6 — CID 142125880
(2-methylpyrimido[4,5-d]pyrimidin-4-yl)hydrazine (PubChem CID 142125880) has the molecular formula C7H8N6 and a molecular weight of 176.18 g/mol. Its IUPAC name is (2-methylpyrimido[4,5-d]pyrimidin-4-yl)hydrazine.
| Compound Name | (2-methylpyrimido[4,5-d]pyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 142125880 |
| Molecular Formula | C7H8N6 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2-methylpyrimido[4,5-d]pyrimidin-4-yl)hydrazine |
| SMILES | Cc1nc(NN)c2cncnc2n1 |
| InChI | InChI=1S/C7H8N6/c1-4-11-6-5(2-9-3-10-6)7(12-4)13-8/h2-3H,8H2,1H3,(H,9,10,11,12,13) |
| InChIKey | XLKROLUVMZYMSY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|