C15H16N6 — CID 80930024
N-(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)isoquinolin-8-amine (PubChem CID 80930024) has the molecular formula C15H16N6 and a molecular weight of 280.34 g/mol. Its IUPAC name is N-(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)isoquinolin-8-amine.
| Compound Name | N-(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)isoquinolin-8-amine |
|---|---|
| PubChem CID | 80930024 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)isoquinolin-8-amine |
| SMILES | Cc1nc(NN)c(C)c(Nc2cccc3ccncc23)n1 |
| InChI | InChI=1S/C15H16N6/c1-9-14(18-10(2)19-15(9)21-16)20-13-5-3-4-11-6-7-17-8-12(11)13/h3-8H,16H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | BLBKSHQNPPKOJM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|