C16H17N5 — CID 80992137
2-ethyl-4-N-isoquinolin-8-yl-5-methylpyrimidine-4,6-diamine (PubChem CID 80992137) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 2-ethyl-4-N-isoquinolin-8-yl-5-methylpyrimidine-4,6-diamine.
| Compound Name | 2-ethyl-4-N-isoquinolin-8-yl-5-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80992137 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-ethyl-4-N-isoquinolin-8-yl-5-methylpyrimidine-4,6-diamine |
| SMILES | CCc1nc(N)c(C)c(Nc2cccc3ccncc23)n1 |
| InChI | InChI=1S/C16H17N5/c1-3-14-20-15(17)10(2)16(21-14)19-13-6-4-5-11-7-8-18-9-12(11)13/h4-9H,3H2,1-2H3,(H3,17,19,20,21) |
| InChIKey | XBTKIDCLOBPSDD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |