C17H24N4 — CID 80976908
4-N-(4-tert-butylphenyl)-2-ethyl-5-methylpyrimidine-4,6-diamine (PubChem CID 80976908) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-N-(4-tert-butylphenyl)-2-ethyl-5-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-tert-butylphenyl)-2-ethyl-5-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80976908 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-N-(4-tert-butylphenyl)-2-ethyl-5-methylpyrimidine-4,6-diamine |
| SMILES | CCc1nc(N)c(C)c(Nc2ccc(C(C)(C)C)cc2)n1 |
| InChI | InChI=1S/C17H24N4/c1-6-14-20-15(18)11(2)16(21-14)19-13-9-7-12(8-10-13)17(3,4)5/h7-10H,6H2,1-5H3,(H3,18,19,20,21) |
| InChIKey | OSYNBASJBXROIX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |