C13H15FN4 — CID 80976619
2-ethyl-4-N-(3-fluorophenyl)-5-methylpyrimidine-4,6-diamine (PubChem CID 80976619) has the molecular formula C13H15FN4 and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-ethyl-4-N-(3-fluorophenyl)-5-methylpyrimidine-4,6-diamine.
| Compound Name | 2-ethyl-4-N-(3-fluorophenyl)-5-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80976619 |
| Molecular Formula | C13H15FN4 |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-ethyl-4-N-(3-fluorophenyl)-5-methylpyrimidine-4,6-diamine |
| SMILES | CCc1nc(N)c(C)c(Nc2cccc(F)c2)n1 |
| InChI | InChI=1S/C13H15FN4/c1-3-11-17-12(15)8(2)13(18-11)16-10-6-4-5-9(14)7-10/h4-7H,3H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | AZORFMCTEJPTEY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |