C6H6N2S2 — CID 57105767
8-methyl-7,8λ4-dithia-3,9-diazabicyclo[4.3.0]nona-1(6),2,4,8-tetraene (PubChem CID 57105767) has the molecular formula C6H6N2S2 and a molecular weight of 170.26 g/mol. Its IUPAC name is 8-methyl-7,8λ4-dithia-3,9-diazabicyclo[4.3.0]nona-1(6),2,4,8-tetraene.
| Compound Name | 8-methyl-7,8λ4-dithia-3,9-diazabicyclo[4.3.0]nona-1(6),2,4,8-tetraene |
|---|---|
| PubChem CID | 57105767 |
| Molecular Formula | C6H6N2S2 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 8-methyl-7,8λ4-dithia-3,9-diazabicyclo[4.3.0]nona-1(6),2,4,8-tetraene |
| SMILES | CS1=Nc2cnccc2S1 |
| InChI | InChI=1S/C6H6N2S2/c1-10-8-5-4-7-3-2-6(5)9-10/h2-4H,1H3 |
| InChIKey | ATIBPGKJVUIILA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|