C9H11NS — CID 21300242
3,3-dimethyl-2H-thieno[3,2-c]pyridine (PubChem CID 21300242) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 3,3-dimethyl-2H-thieno[3,2-c]pyridine.
| Compound Name | 3,3-dimethyl-2H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 21300242 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 3,3-dimethyl-2H-thieno[3,2-c]pyridine |
| SMILES | CC1(C)CSc2ccncc21 |
| InChI | InChI=1S/C9H11NS/c1-9(2)6-11-8-3-4-10-5-7(8)9/h3-5H,6H2,1-2H3 |
| InChIKey | XCPSPTCFLNYACY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |