C19H19NOS — CID 66616032
3-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-1-pyridin-3-ylprop-2-yn-1-ol (PubChem CID 66616032) has the molecular formula C19H19NOS and a molecular weight of 309.43 g/mol. Its IUPAC name is 3-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-1-pyridin-3-ylprop-2-yn-1-ol.
| Compound Name | 3-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-1-pyridin-3-ylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 66616032 |
| Molecular Formula | C19H19NOS |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)-1-pyridin-3-ylprop-2-yn-1-ol |
| SMILES | CC1(C)CCSc2ccc(C#CC(O)c3cccnc3)cc21 |
| InChI | InChI=1S/C19H19NOS/c1-19(2)9-11-22-18-8-6-14(12-16(18)19)5-7-17(21)15-4-3-10-20-13-15/h3-4,6,8,10,12-13,17,21H,9,11H2,1-2H3 |
| InChIKey | ZLEVWQKMSJUQIL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|