C19H19NO2S2 — CID 87075590
3-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]-1-pyridin-3-ylprop-2-yn-1-ol (PubChem CID 87075590) has the molecular formula C19H19NO2S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]-1-pyridin-3-ylprop-2-yn-1-ol.
| Compound Name | 3-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]-1-pyridin-3-ylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 87075590 |
| Molecular Formula | C19H19NO2S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 3-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]-1-pyridin-3-ylprop-2-yn-1-ol |
| SMILES | CSC1(SC)CCOc2ccc(C#CC(O)c3cccnc3)cc21 |
| InChI | InChI=1S/C19H19NO2S2/c1-23-19(24-2)9-11-22-18-8-6-14(12-16(18)19)5-7-17(21)15-4-3-10-20-13-15/h3-4,6,8,10,12-13,17,21H,9,11H2,1-2H3 |
| InChIKey | IAKVGXXNPFEEGX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|