C24H27NO3S — CID 174520672
ethyl 4-(7-ethylsulfanyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)-2-pyridin-3-ylbut-3-ynoate (PubChem CID 174520672) has the molecular formula C24H27NO3S and a molecular weight of 409.55 g/mol. Its IUPAC name is ethyl 4-(7-ethylsulfanyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)-2-pyridin-3-ylbut-3-ynoate.
| Compound Name | ethyl 4-(7-ethylsulfanyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)-2-pyridin-3-ylbut-3-ynoate |
|---|---|
| PubChem CID | 174520672 |
| Molecular Formula | C24H27NO3S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | ethyl 4-(7-ethylsulfanyl-4,4-dimethyl-2,3-dihydrochromen-6-yl)-2-pyridin-3-ylbut-3-ynoate |
| SMILES | CCOC(=O)C(C#Cc1cc2c(cc1SCC)OCCC2(C)C)c1cccnc1 |
| InChI | InChI=1S/C24H27NO3S/c1-5-27-23(26)19(18-8-7-12-25-16-18)10-9-17-14-20-21(15-22(17)29-6-2)28-13-11-24(20,3)4/h7-8,12,14-16,19H,5-6,11,13H2,1-4H3 |
| InChIKey | BWZRHOYRQGMFBJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|