C15H19N3O2 — CID 129362508
ethyl 4-[(R)-cyano(pyridin-3-yl)methyl]piperidine-1-carboxylate (PubChem CID 129362508) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is ethyl 4-[(R)-cyano(pyridin-3-yl)methyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(R)-cyano(pyridin-3-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 129362508 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | ethyl 4-[(R)-cyano(pyridin-3-yl)methyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC([C@@H](C#N)c2cccnc2)CC1 |
| InChI | InChI=1S/C15H19N3O2/c1-2-20-15(19)18-8-5-12(6-9-18)14(10-16)13-4-3-7-17-11-13/h3-4,7,11-12,14H,2,5-6,8-9H2,1H3/t14-/m1/s1 |
| InChIKey | ATPZVRRAZNWBNX-CQSZACIVSA-N |
| XLogP | 2.56 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |