C23H24O3S3 — CID 57101703
ethyl 3-[2-[4,4,7-tris(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate (PubChem CID 57101703) has the molecular formula C23H24O3S3 and a molecular weight of 444.64 g/mol. Its IUPAC name is ethyl 3-[2-[4,4,7-tris(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate.
| Compound Name | ethyl 3-[2-[4,4,7-tris(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 57101703 |
| Molecular Formula | C23H24O3S3 |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | ethyl 3-[2-[4,4,7-tris(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1cccc(C#Cc2cc3c(cc2SC)OCCC3(SC)SC)c1 |
| InChI | InChI=1S/C23H24O3S3/c1-5-25-22(24)18-8-6-7-16(13-18)9-10-17-14-19-20(15-21(17)27-2)26-12-11-23(19,28-3)29-4/h6-8,13-15H,5,11-12H2,1-4H3 |
| InChIKey | VNLVGPNAQAQETI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|