C20H17NO3S — CID 145364688
4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-nitrobenzaldehyde (PubChem CID 145364688) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is 4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-nitrobenzaldehyde.
| Compound Name | 4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 145364688 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-[2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]-3-nitrobenzaldehyde |
| SMILES | CC1(C)CCSc2ccc(C#Cc3ccc(C=O)cc3[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H17NO3S/c1-20(2)9-10-25-19-8-5-14(11-17(19)20)3-6-16-7-4-15(13-22)12-18(16)21(23)24/h4-5,7-8,11-13H,9-10H2,1-2H3 |
| InChIKey | MXNAWYIFWHEOFR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|