C10H6N2S2 — CID 11506792
2,9-dithia-5,13-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene (PubChem CID 11506792) has the molecular formula C10H6N2S2 and a molecular weight of 218.31 g/mol. Its IUPAC name is 2,9-dithia-5,13-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene.
| Compound Name | 2,9-dithia-5,13-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 11506792 |
| Molecular Formula | C10H6N2S2 |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 2,9-dithia-5,13-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
| SMILES | c1cc2c(cn1)Sc1cnccc1S2 |
| InChI | InChI=1S/C10H6N2S2/c1-3-11-5-9-7(1)13-8-2-4-12-6-10(8)14-9/h1-6H |
| InChIKey | NZMPGBXMYOWBAG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |