C11H13NO — CID 12648560
5,5-dimethyl-6,7-dihydroisoquinolin-8-one (PubChem CID 12648560) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 5,5-dimethyl-6,7-dihydroisoquinolin-8-one.
| Compound Name | 5,5-dimethyl-6,7-dihydroisoquinolin-8-one |
|---|---|
| PubChem CID | 12648560 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5,5-dimethyl-6,7-dihydroisoquinolin-8-one |
| SMILES | CC1(C)CCC(=O)c2cnccc21 |
| InChI | InChI=1S/C11H13NO/c1-11(2)5-3-10(13)8-7-12-6-4-9(8)11/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | MHYMYKOEUYRZOB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |