C13H15IO2 — CID 143066066
(3,8,8-trimethyl-5-oxo-6,7-dihydronaphthalen-2-yl) hypoiodite (PubChem CID 143066066) has the molecular formula C13H15IO2 and a molecular weight of 330.17 g/mol. Its IUPAC name is (3,8,8-trimethyl-5-oxo-6,7-dihydronaphthalen-2-yl) hypoiodite.
| Compound Name | (3,8,8-trimethyl-5-oxo-6,7-dihydronaphthalen-2-yl) hypoiodite |
|---|---|
| PubChem CID | 143066066 |
| Molecular Formula | C13H15IO2 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | (3,8,8-trimethyl-5-oxo-6,7-dihydronaphthalen-2-yl) hypoiodite |
| SMILES | Cc1cc2c(cc1OI)C(C)(C)CCC2=O |
| InChI | InChI=1S/C13H15IO2/c1-8-6-9-10(7-12(8)16-14)13(2,3)5-4-11(9)15/h6-7H,4-5H2,1-3H3 |
| InChIKey | SOWDHRBOLZLCTD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|